A2493112
1-(4-Chlorophenyl)cyclobutaneCarbonitrile , 97% , 28049-61-8
CAS NO.：28049-61-8
Empirical Formula: C11H10ClN
Molecular Weight: 191.66
MDL number: MFCD00065239
EINECS: 248-799-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB159.20 | In Stock |
|
| 5G | RMB521.60 | In Stock |
|
| 25G | RMB1651.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 295 °C (lit.) |
| Density | 1.137 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Sparingly), Methanol (Slightly) |
| form | Oil |
| color | Clear Colourless to Pale Yellow |
| InChI | InChI=1S/C11H10ClN/c12-10-4-2-9(3-5-10)11(8-13)6-1-7-11/h2-5H,1,6-7H2 |
| InChIKey | XQONXPWVIZZJIL-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=C(Cl)C=C2)(C#N)CCC1 |
| CAS DataBase Reference | 28049-61-8(CAS DataBase Reference) |
Description and Uses
An intermediate in the preparation of Sibutramine and respective metabolites
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352+P312-P304+P340+P312 |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 36-36/37/39-26 |
| RIDADR | UN3276 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269095 |
