A2493612
2-Chloro-6-methyl-3-nitropyridine , ≥98.0%(GC) , 56057-19-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB28.80 | In Stock |
|
| 5G | RMB86.40 | In Stock |
|
| 25G | RMB358.40 | In Stock |
|
| 100g | RMB1336.80 | In Stock |
|
| 500g | RMB5205.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 70-74 °C |
| Boiling point: | 200°C (rough estimate) |
| Density | 1.5610 (rough estimate) |
| refractive index | 1.5500 (estimate) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | soluble in Methanol |
| form | Powder |
| pka | -1?+-.0.10(Predicted) |
| color | Brown |
| InChI | InChI=1S/C6H5ClN2O2/c1-4-2-3-5(9(10)11)6(7)8-4/h2-3H,1H3 |
| InChIKey | UIEVSGOVFXWCIK-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC(C)=CC=C1[N+]([O-])=O |
| CAS DataBase Reference | 56057-19-3(CAS DataBase Reference) |
Description and Uses
Iridium complexes with 2-phenylpyridine and 2-(4-dibenzofuran)pyridine as ligands are widely used organic phosphorescent materials.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xn,T,Xi |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 36/37/39-26-36 |
| HS Code | 29349990 |
