PRODUCT Properties
| Melting point: | 78-80 °C |
| Boiling point: | 250 °C (1 mmHg) |
| Density | 0.9090 |
| refractive index | 1.4887 |
| storage temp. | room temp |
| solubility | DMF: 1 mg/ml DMSO: 0.1 mg/ml Ethanol: 20 mg/ml Ethanol: PBS (pH 7.2)(1:2): 0.1 mg/mlPBS (pH 7.2): 0.1 mg/ml |
| form | Crystalline Powder |
| color | White |
| Merck | 13,2219 |
| BRN | 2051806 |
| InChI | 1S/C27H48/c1-19(2)9-8-10-20(3)23-14-15-24-22-13-12-21-11-6-7-17-26(21,4)25(22)16-18-27(23,24)5/h19-25H,6-18H2,1-5H3/t20-,21-,22+,23-,24+,25+,26+,27-/m1/s1 |
| InChIKey | XIIAYQZJNBULGD-XWLABEFZSA-N |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC[C@H]4CCCC[C@]4(C)[C@H]3CC[C@]12C |
| LogP | 11.945 (est) |
| CAS DataBase Reference | 481-21-0(CAS DataBase Reference) |
| EPA Substance Registry System | Cholestane, (5.alpha.)- (481-21-0) |
Description and Uses
5α-Cholestane is a sterol that has been found in dust samples from urban and rural paved and agricultural and public unpaved roads. It has been used as an internal standard for the quantification of phytosterols by HPLC-MS/MS and fecal sterols by GC-FID and GC-MS.
5α-Cholestane was used as standard in cholesterol analysis by GC and HPLC.
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H302-H315-H319-H331-H336-H351-H361d-H372-H412 |
| Precautionary statements | P201-P273-P301+P312+P330-P302+P352-P304+P340+P311-P308+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn |
| Risk Statements | 22-38-40-48/20/22-67-36/38-20-63 |
| Safety Statements | 24/25-36/37-26 |
| RIDADR | UN 1888 6.1/PG 3 |
| WGK Germany | 3 |
| HS Code | 29021990 |
| Storage Class | 11 - Combustible Solids |






