A2497812
Chromone-3-carboxylicacid , 97% , 39079-62-4
| Pack Size | Price | Stock | Quantity |
| 200MG | RMB71.20 | In Stock |
|
| 1G | RMB183.20 | In Stock |
|
| 5G | RMB648.80 | In Stock |
|
| 25g | RMB3086.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 202-205 °C (lit.) |
| Boiling point: | 245.64°C (rough estimate) |
| Density | 1.493 |
| refractive index | 1.4440 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 2.55±0.20(Predicted) |
| color | Pale Yellow |
| BRN | 1074111 |
| InChI | InChI=1S/C10H6O4/c11-9-6-3-1-2-4-8(6)14-5-7(9)10(12)13/h1-5H,(H,12,13) |
| InChIKey | PCIITXGDSHXTSN-UHFFFAOYSA-N |
| SMILES | C1OC2=CC=CC=C2C(=O)C=1C(O)=O |
| CAS DataBase Reference | 39079-62-4(CAS DataBase Reference) |
Description and Uses
Chromone-3-carboxylic acid may be used in the preparation of:
- chromane-2,4-diones
- chromone-3-carboxamides
- 5-(2-hydroxyphenyl)isoxazole
- chromone-2-carboxamides
- chromone-2-carboxamido-3-esters
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26-36 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 2916399090 |
| Storage Class | 11 - Combustible Solids |






