A2498612
5-Chloroisatin , 98% , 17630-76-1
Synonym(s):
5-Chloro-1H-indole-2,3-dione
CAS NO.：17630-76-1
Empirical Formula: C8H4ClNO2
Molecular Weight: 181.58
MDL number: MFCD00014567
EINECS: 241-614-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB36.00 | In Stock |
|
| 25G | RMB127.20 | In Stock |
|
| 100G | RMB479.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 254-258 °C (lit.) |
| Density | 1.3743 (rough estimate) |
| refractive index | 1.5560 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 8.65±0.20(Predicted) |
| form | Powder |
| Appearance | Yellow to orange Solid |
| Water Solubility | insoluble |
| BRN | 383759 |
| InChI | InChI=1S/C8H4ClNO2/c9-4-1-2-6-5(3-4)7(11)8(12)10-6/h1-3H,(H,10,11,12) |
| InChIKey | XHDJYQWGFIBCEP-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=C(Cl)C=C2)C(=O)C1=O |
| CAS DataBase Reference | 17630-76-1(CAS DataBase Reference) |
Description and Uses
5-Chloroisatin is a reagent used in the synthesis of Schiff bases through the reaction with 2-methyl-4-nitroaniline or 4-amino-4,5-dihydro-1H-1,2,3-triazole-5-one.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29339900 |
