PRODUCT Properties
| Melting point: | 114 °C |
| Boiling point: | 534.5±50.0 °C(Predicted) |
| Density | 1.2205 (rough estimate) |
| refractive index | 1.6300 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | -2.37±0.40(Predicted) |
| color | White to Pale Yellow |
| Merck | 14,2106 |
| InChI | InChI=1S/C11H12ClNO3S/c1-13-10(14)6-7-17(15,16)11(13)8-2-4-9(12)5-3-8/h2-5,11H,6-7H2,1H3 |
| InChIKey | WEQAYVWKMWHEJO-UHFFFAOYSA-N |
| SMILES | S1(=O)(=O)CCC(=O)N(C)C1C1=CC=C(Cl)C=C1 |
| NIST Chemistry Reference | Chlormezanone(80-77-3) |
Description and Uses
Skeletal muscle relaxant
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P301+P312a-P330-P501a-P264-P270-P301+P312+P330-P501 |
| RTECS | XJ1050000 |
| HS Code | 2934.99.4400 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
| Hazardous Substances Data | 80-77-3(Hazardous Substances Data) |





