A2499212
                    Calcifediol , ≥98%(HPLC) , 19356-17-3
                            Synonym(s):
25-Hydroxycholecalciferol solution;25-Hydroxyvitamin D3
                            
                        
                CAS NO.:19356-17-3
Empirical Formula: C27H44O2
Molecular Weight: 400.65
MDL number: MFCD00867077
EINECS: 242-990-9
| Pack Size | Price | Stock | Quantity | 
| 5MG | RMB687.20 | In Stock | 
                                                 | 
                                        
| 25MG | RMB2159.20 | In Stock | 
                                                 | 
                                        
| 100MG | RMB5199.20 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Melting point: | 74-76oC | 
                                    
| Boiling point: | 529.2±33.0 °C(Predicted) | 
                                    
| Density | 1.01±0.1 g/cm3(Predicted) | 
                                    
| Flash point: | 14 °C | 
                                    
| storage temp. | -20°C | 
                                    
| solubility | DMF: 20 mg/ml; DMSO: 10 mg/ml; Ethanol: 20 mg/ml; Ethanol:PBS (pH 7.2)(1:2): 0.3 mg/ml | 
                                    
| pka | 14.74±0.20(Predicted) | 
                                    
| form | White to off-white crystalline solid. | 
                                    
| color | White to off-white | 
                                    
| biological source | synthetic | 
                                    
| Stability: | Light Sensitive, Temperature Sensitive | 
                                    
| InChIKey | JWUBBDSIWDLEOM-DTOXIADCSA-N | 
                                    
| SMILES | C[C@]12CCC/C(=C\C=C3\C[C@@H](O)CCC\3=C)/[C@]1([H])CC[C@]2([H])[C@H](C)CCCC(O)(C)C |&1:1,10,16,20,22,r| | 
                                    
Description and Uses
A metabolite of Vitamin D. The principal circulating form of vitamin D3, formed in the liver by hydroxylation at C-25. Calcium regulator.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07  | 
                                    
| Signal word | Danger | 
| Hazard statements | H225-H319 | 
| Precautionary statements | P210-P305+P351+P338 | 
| Hazard Codes | T+,F | 
| Risk Statements | 28-48/25-26-24/25-11 | 
| Safety Statements | 28-36/37-45-16-7 | 
| RIDADR | UN 2811 6.1/PG 2 | 
| WGK Germany | 3 | 
| F | 8-10-19 | 
| HazardClass | 6.1 | 
| PackingGroup | Ⅱ | 
| HS Code | 29362900 | 







