A2499812
4-Chlorobutyric Acid , >95.0%(T) , 627-00-9
CAS NO.:627-00-9
Empirical Formula: C4H7ClO2
Molecular Weight: 122.55
MDL number: MFCD00002818
EINECS: 210-977-7
| Pack Size | Price | Stock | Quantity |
| 5G | RMB54.40 | In Stock |
|
| 25G | RMB182.40 | In Stock |
|
| 100G | RMB582.40 | In Stock |
|
| 500G | RMB2294.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 12-16 °C(lit.) |
| Boiling point: | 196 °C22 mm Hg(lit.) |
| Density | 1.24 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Ether |
| pka | 4.52(at RT℃) |
| form | clear liquid |
| color | Colorless to Almost colorless |
| BRN | 1700264 |
| InChI | InChI=1S/C4H7ClO2/c5-3-1-2-4(6)7/h1-3H2,(H,6,7) |
| InChIKey | IPLKGJHGWCVSOG-UHFFFAOYSA-N |
| SMILES | C(O)(=O)CCCCl |
| CAS DataBase Reference | 627-00-9(CAS DataBase Reference) |
| EPA Substance Registry System | 4-Chlorobutyric acid (627-00-9) |
Description and Uses
4-Chlorobutanoic Acid is an impurity of Levetiracetam(L331500) which is (S)-enantiomer of Etiracetam (E932970) and the ethyl analog of Piracetam (P500800). Used as an anticonvulsant. Neuroprotective & Neuroresearch Product.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H314 |
| Precautionary statements | P270-P280-P301+P312-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 22-34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29159000 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Skin Corr. 1B |







