A4024312
Ethyl 4-Chlorobutyrate , ≥98.0%(GC) , 3153-36-4
CAS NO.：3153-36-4
Empirical Formula: C6H11ClO2
Molecular Weight: 150.6
MDL number: MFCD00001004
EINECS: 221-591-3
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 186 °C(lit.) |
| Density | 1.075 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 125 °F |
| storage temp. | Flammables area |
| form | Liquid |
| color | Clear yellow to brownish |
| Water Solubility | Insoluble |
| BRN | 1098810 |
| InChI | InChI=1S/C6H11ClO2/c1-2-9-6(8)4-3-5-7/h2-5H2,1H3 |
| InChIKey | OPXNFHAILOHHFO-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)CCCCl |
| CAS DataBase Reference | 3153-36-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Butanoic acid, 4-chloro-, ethyl ester(3153-36-4) |
Description and Uses
Ethyl 4-chlorobutyrate is a reagent used in the preparation of cyclopropane derivatives.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22-10 |
| Safety Statements | 26-36-37/39-16-24/25 |
| RIDADR | 1993 |
| WGK Germany | 3 |
| F | 21 |
| HazardClass | 3.2 |
| PackingGroup | III |
| HS Code | 29159000 |
