A2500112
4,4'-Difluorobenzhydryl Chloride , ≥97.0%(GC) , 27064-94-4
Synonym(s):
4,4′-Difluorobenzhydryl chloride
CAS NO.：27064-94-4
Empirical Formula: C13H9ClF2
Molecular Weight: 238.66
MDL number: MFCD00044329
EINECS: 248-201-4
| Pack Size | Price | Stock | Quantity |
| 5G | RMB103.20 | In Stock |
|
| 25G | RMB399.20 | In Stock |
|
| 100G | RMB1279.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 126-128 °C1 mm Hg(lit.) |
| Density | 1.28 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Storage temp. 2-8°C |
| form | Liquid |
| color | Clear colorless to slightly yellow |
| Sensitive | Moisture Sensitive |
| BRN | 2052680 |
| InChI | InChI=1S/C13H9ClF2/c14-13(9-1-5-11(15)6-2-9)10-3-7-12(16)8-4-10/h1-8,13H |
| InChIKey | FHPNLCLHMNPLEW-UHFFFAOYSA-N |
| SMILES | C(C1=CC=C(F)C=C1)(C1=CC=C(F)C=C1)Cl |
| CAS DataBase Reference | 27064-94-4(CAS DataBase Reference) |
Description and Uses
Chlorobis(4-fluorophenyl)methane is a compound involved in the synthesis of 1-[bis(4-fluorophenyl)methyl]-4-cinnamylpiperazine, a T-type calcium channel blocker and anti-ischemic drug.
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H314-H335 |
| Precautionary statements | P261-P271-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| Hazard Codes | C,Xi,Xn |
| Risk Statements | 34-36/37-38-22 |
| Safety Statements | 26-27-28-36/37/39-45-38-37/39-28B |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29036990 |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |
