A2501812
5-Chloro-2-methoxybenzoic acid , ≥98.0% , 3438-16-2
Synonym(s):
5-Chloro-o-anisic acid
CAS NO.:3438-16-2
Empirical Formula: C8H7ClO3
Molecular Weight: 186.59
MDL number: MFCD00017546
EINECS: 222-343-7
| Pack Size | Price | Stock | Quantity |
| 5G | RMB25.60 | In Stock |
|
| 25G | RMB55.20 | In Stock |
|
| 100G | RMB150.40 | In Stock |
|
| 250G | RMB358.40 | In Stock |
|
| 500G | RMB679.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 98-100 °C (lit.) |
| Boiling point: | 150-152C |
| Density | 1,259g/cm |
| refractive index | 1,544-1546 |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform, Methanol |
| form | Crystalline Powder |
| pka | 3.72±0.10(Predicted) |
| color | White to off-white |
| Henry's Law Constant | 2.1×103 mol/(m3Pa) at 25℃, Zhang et al. (2010) |
| InChI | InChI=1S/C8H7ClO3/c1-12-7-3-2-5(9)4-6(7)8(10)11/h2-4H,1H3,(H,10,11) |
| InChIKey | HULDRQRKKXRXBI-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC(Cl)=CC=C1OC |
| LogP | 2.368 (est) |
| CAS DataBase Reference | 3438-16-2(CAS DataBase Reference) |
Description and Uses
5-Chloro-2-methoxybenzoic acid has been used in the synthesis of 5-chloro-2-methoxybenzoates of La(III), Ga(III) and Lu(III).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-36 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29189900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





