A2506712
5-Acetyl-3-chloro-10,11-dihydrodibenzo[b,f]azepine , ≥98.0%(GC)(N) , 25961-11-9
CAS NO.:25961-11-9
Empirical Formula: C16H14ClNO
Molecular Weight: 271.74
MDL number: MFCD01632170
EINECS: 247-371-7
| Pack Size | Price | Stock | Quantity |
| 5G | RMB93.60 | In Stock |
|
| 25G | RMB195.20 | In Stock |
|
| 100G | RMB568.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 124 °C |
| Boiling point: | 481.2±45.0 °C(Predicted) |
| Density | 1.246±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | -3.29±0.20(Predicted) |
| color | White |
| InChI | InChI=1S/C16H14ClNO/c1-11(19)18-15-5-3-2-4-12(15)6-7-13-8-9-14(17)10-16(13)18/h2-5,8-10H,6-7H2,1H3 |
| InChIKey | NMZOSOMVILZBJL-UHFFFAOYSA-N |
| SMILES | C(=O)(N1C2=CC=CC=C2CCC2=CC=C(Cl)C=C12)C |
| CAS DataBase Reference | 25961-11-9(CAS DataBase Reference) |
Description and Uses
5-Acetyl-3-chloroiminodibenzyl is used as a reactant in various syntheses. It was used in the synthesis of solid pyridylzinc reagents with application in Negishi Reactions. Carbamazephine Impurity 1.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P280-P305+P351+P338 |
| HS Code | 2933.99.8290 |

![5-Acetyl-3-chloro-10,11-dihydrodibenzo[b,f]azepine](https://img.chemicalbook.com/CAS/GIF/25961-11-9.gif)




![1-(10,11-Dihydro-5H-dibenzo[b,f]azepin-5-yl)ethanone](https://img.chemicalbook.com/CAS/GIF/13080-75-6.gif)