A2507012
4-Chlorobenzyl Bromide , ≥97.0%(GC) , 622-95-7
CAS NO.:622-95-7
Empirical Formula: C7H6BrCl
Molecular Weight: 205.48
MDL number: MFCD00040714
EINECS: 210-760-7
| Pack Size | Price | Stock | Quantity |
| 5G | RMB52.80 | In Stock |
|
| 25G | RMB143.20 | In Stock |
|
| 100G | RMB463.20 | In Stock |
|
| 500g | RMB2079.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 48-52 °C (lit.) |
| Boiling point: | 107-108°C 8mm |
| Density | 1.570±0.06 g/cm3(Predicted) |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Chloroform, Dichloromethane (Slightly) |
| form | Crystalline Low Melting Solid |
| color | White |
| Water Solubility | Insoluble in water. |
| Sensitive | Lachrymatory |
| BRN | 606497 |
| InChI | InChI=1S/C7H6BrCl/c8-5-6-1-3-7(9)4-2-6/h1-4H,5H2 |
| InChIKey | KQNBRMUBPRGXSL-UHFFFAOYSA-N |
| SMILES | C1(CBr)=CC=C(Cl)C=C1 |
| CAS DataBase Reference | 622-95-7(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Chlorobenzyl bromide(622-95-7) |
Description and Uses
4-Chlorobenzyl bromide may be used to synthesize 1-(4-chlorobenzyl)-2-(pyrrolidin-1-yl-methyl)-1H-benzimidazole dihydrochloride
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 1759 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Corrosive/Lachrymatory |
| HazardClass | 6.1 |
| PackingGroup | II |
| HS Code | 29049090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |






