A2509012
2-Chloro-5-fluorotoluene , ≥98.0%(HPLC) , 3337-62-0
CAS NO.:3337-62-0
Empirical Formula: C7H4Br2O3
Molecular Weight: 295.91
MDL number: MFCD00002548
EINECS: 222-075-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB39.20 | In Stock |
|
| 25G | RMB70.40 | In Stock |
|
| 100G | RMB238.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 271-274 °C |
| Boiling point: | 342.0±42.0 °C(Predicted) |
| Density | 2.0591 (rough estimate) |
| refractive index | 1.4947 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO (Sparingly), Methanol (Slightly) |
| form | Solid |
| pka | 3.79±0.10(Predicted) |
| color | White to Off-White |
| BRN | 2416147 |
| InChI | InChI=1S/C7H4Br2O3/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1-2,10H,(H,11,12) |
| InChIKey | PHWAJJWKNLWZGJ-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC(Br)=C(O)C(Br)=C1 |
| CAS DataBase Reference | 3337-62-0(CAS DataBase Reference) |
| NIST Chemistry Reference | 3,5-Dibromo-4-hydroxybenzoic acid(3337-62-0) |
| EPA Substance Registry System | Benzoic acid, 3,5-dibromo-4-hydroxy- (3337-62-0) |
Description and Uses
3,5-Dibromo-4-hydroxybenzoic Acid is an intermediate used to prepare benzbromarone (B185200) which is a uricosuric agent used in the treatment of gout and hyperuricemia.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi,C |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-37/39-26 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29163900 |





