A2514412
Cyclohexene-1-boronic acid , 97% , 89490-05-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB64.00 | In Stock |
|
| 5G | RMB159.20 | In Stock |
|
| 25G | RMB720.00 | In Stock |
|
| 100g | RMB2496.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 165°C |
| Boiling point: | 261.9±33.0 °C(Predicted) |
| Density | 1.05±0.1 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| form | Powder |
| pka | 9.43±0.20(Predicted) |
| color | White to off-white |
| InChI | InChI=1S/C6H11BO2/c8-7(9)6-4-2-1-3-5-6/h4,8-9H,1-3,5H2 |
| InChIKey | XZWQKJXJNKYMAP-UHFFFAOYSA-N |
| SMILES | C1CCCCC=1B(O)O |
| CAS DataBase Reference | 89490-05-1(CAS DataBase Reference) |
Description and Uses
1-Cyclohexenylboronic acid serves as an alkenyl substrate in a one-pot bimetal catalytic system with DABSO and O-benzoyl hydroxylamines to afford the corresponding sulfonamide product 4-(1-cyclohexen-1-ylsulfonyl)morpholine[2].
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39-60-37 |
| WGK Germany | WGK 3 |
| HS Code | 29319090 |
| Storage Class | 11 - Combustible Solids |



![1,4-Dioxaspiro[4,5]dec-7-en-8-boronic Acid Pinacol Ester](https://img.chemicalbook.com/CAS/GIF/680596-79-6.gif)


