A2517412
2-Chlorobenzimidazole , ≥97.0% , 4857-06-1
CAS NO.:4857-06-1
Empirical Formula: C7H5ClN2
Molecular Weight: 152.58
MDL number: MFCD00051944
EINECS: 225-453-3
| Pack Size | Price | Stock | Quantity |
| 5G | RMB38.40 | In Stock |
|
| 25G | RMB108.00 | In Stock |
|
| 100G | RMB374.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 207-211 °C (lit.) |
| Boiling point: | 250.67°C (rough estimate) |
| Density | 1.2763 (rough estimate) |
| refractive index | 1.5500 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | Crystalline Powder |
| pka | 9.81±0.10(Predicted) |
| color | Beige to brown |
| Water Solubility | Insoluble in water. |
| Sensitive | Moisture Sensitive |
| BRN | 116526 |
| InChI | InChI=1S/C7H5ClN2/c8-7-9-5-3-1-2-4-6(5)10-7/h1-4H,(H,9,10) |
| InChIKey | AYPSHJCKSDNETA-UHFFFAOYSA-N |
| SMILES | C1(Cl)NC2=CC=CC=C2N=1 |
| CAS DataBase Reference | 4857-06-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Chlorobenzimidazole(4857-06-1) |
| EPA Substance Registry System | 1H-Benzimidazole, 2-chloro- (4857-06-1) |
Description and Uses
2-Chlorobenzimidazole is mainly used for the synthesis of medicine and as an intermediate in organic synthesis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HS Code | 29332900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







