A2519112
2-Chloro-5-nitropyrimidine , ≥98.0% , 10320-42-0
CAS NO.:10320-42-0
Empirical Formula: C4H2ClN3O2
Molecular Weight: 159.53
MDL number: MFCD04117995
EINECS: 233-703-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB111.20 | In Stock |
|
| 5G | RMB399.20 | In Stock |
|
| 25g | RMB1359.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 105-110 °C |
| Boiling point: | 345.4±15.0 °C(Predicted) |
| Density | 1.600±0.06 g/cm3(Predicted) |
| storage temp. | -20°C |
| form | powder to crystal |
| pka | -4.60±0.22(Predicted) |
| color | Light orange to Yellow to Green |
| InChI | InChI=1S/C4H2ClN3O2/c5-4-6-1-3(2-7-4)8(9)10/h1-2H |
| InChIKey | OFCBNMYNAHUDGE-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=C([N+]([O-])=O)C=N1 |
| CAS DataBase Reference | 10320-42-0(CAS DataBase Reference) |
Description and Uses
2-Chloro-5-nitropyrimidine is an advanced intermediate for kinase/PRMT1 inhibitors, antiviral drugs, and other purine drugs. It can also be converted into herbicides, fungicides, and insecticides, providing targeted crop protection while maintaining good environmental friendliness.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H317-H318-H335 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338+P310 |
| target organs | Respiratory system |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-43-41-37/38-22-20/21/22 |
| Safety Statements | 26-36-37/39-36/37/39-36/37-24/25 |
| RIDADR | UN 3335 |
| WGK Germany | 3 |
| RTECS | US7175000 |
| HazardClass | IRRITANT |
| HS Code | 29335990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |








