BD9894231
2,4-Dichloro-6-methyl-5-nitropyrimidine , 98% , 13162-26-0
CAS NO.：13162-26-0
Empirical Formula: C5H3Cl2N3O2
Molecular Weight: 208
MDL number: MFCD00023196
EINECS: 825-790-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB28.80 | In Stock |
|
| 5g | RMB108.80 | In Stock |
|
| 10g | RMB172.80 | In Stock |
|
| 25g | RMB356.00 | In Stock |
|
| 100g | RMB1016.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 52-54°C |
| Boiling point: | 135-136 °C(Press: 22 Torr) |
| Density | 1.626±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | -5.30±0.39(Predicted) |
| color | Pale Yellow to Light Beige |
| Stability: | Moisture Sensitive |
| InChI | InChI=1S/C5H3Cl2N3O2/c1-2-3(10(11)12)4(6)9-5(7)8-2/h1H3 |
| InChIKey | NBCOZXBHPKSFSA-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC(C)=C([N+]([O-])=O)C(Cl)=N1 |
| CAS DataBase Reference | 13162-26-0(CAS DataBase Reference) |
Description and Uses
A synthetic intermediate
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 22-41-36/37/38 |
| Safety Statements | 26-39-36/37/39 |
| HS Code | 29335990 |
