A6731512
Pirimiphos-methyl solution , analyticalstandard,0.100mg/mlinmethanol , 29232-93-7
CAS NO.:29232-93-7
Empirical Formula: C11H20N3O3PS
Molecular Weight: 305.33
MDL number: MFCD00055366
EINECS: 249-528-5
| Pack Size | Price | Stock | Quantity |
| 2ML | RMB143.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 15°C |
| Boiling point: | 386.5±52.0 °C(Predicted) |
| Density | d30 1.157 |
| vapor pressure | 1.5×10-2 Pa (30°C) |
| refractive index | nD25 1.527 |
| Flash point: | -18 °C |
| storage temp. | APPROX 4°C |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| pka | 3.71 |
| Water Solubility | 9.9 mg l-1 (30 °C, pH 5.2) |
| form | Liquid |
| color | Light yellow to yellow |
| Merck | 13,7580 |
| BRN | 755726 |
| Major Application | agriculture environmental |
| InChI | 1S/C11H20N3O3PS/c1-6-14(7-2)11-12-9(3)8-10(13-11)17-18(19,15-4)16-5/h8H,6-7H2,1-5H3 |
| InChIKey | QHOQHJPRIBSPCY-UHFFFAOYSA-N |
| SMILES | CCN(CC)c1nc(C)cc(OP(=S)(OC)OC)n1 |
| LogP | 4.2 at 20℃ |
| CAS DataBase Reference | 29232-93-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Pirimiphos methyl(29232-93-7) |
| EPA Substance Registry System | Pirimiphos-methyl (29232-93-7) |
Description and Uses
Pirimiphos-methyl is used to control a wide range of insect and mite pests in stored products and a wide range of insects and mites on agricultural crops, particularly sucking pests under glass.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS07,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H302-H370-H372-H410 |
| Precautionary statements | P260-P264-P270-P273-P301+P312-P308+P311 |
| target organs | Nervous system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn,N,F |
| Risk Statements | 22-50/53-67-65-38-11 |
| Safety Statements | 60-61-62 |
| RIDADR | UN3082 9/PG 3 |
| WGK Germany | 3 |
| RTECS | TF1410000 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 STOT RE 1 STOT SE 1 |
| Hazardous Substances Data | 29232-93-7(Hazardous Substances Data) |





![Bis[tetrakis(hydroxymethyl)phosphonium] sulfate solution](https://img.chemicalbook.com/CAS/GIF/55566-30-8.gif)
