A2524212
2-Cyanobenzyl Chloride , ≥98.0%(GC) , 612-13-5
CAS NO.：612-13-5
Empirical Formula: C8H6ClN
Molecular Weight: 151.59
MDL number: MFCD00019745
EINECS: 210-292-3
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.80 | In Stock |
|
| 25G | RMB32.80 | In Stock |
|
| 100G | RMB84.00 | In Stock |
|
| 500G | RMB276.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 56-61°C |
| Boiling point: | 252°C(lit.) |
| Density | 1.1976 (rough estimate) |
| refractive index | 1.5437 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| color | White to Almost white |
| InChI | InChI=1S/C8H6ClN/c9-5-7-3-1-2-4-8(7)6-10/h1-4H,5H2 |
| InChIKey | ZSHNOXOGXHXLAV-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=CC=C1CCl |
| CAS DataBase Reference | 612-13-5(CAS DataBase Reference) |
Safety
| Symbol(GHS) |   GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H314 |
| Precautionary statements | P501-P260-P270-P264-P280-P303+P361+P353-P301+P330+P331-P363-P301+P310+P330-P304+P340+P310-P305+P351+P338+P310-P405 |
| RIDADR | UN 2923 8/6.1/PG II |
| HazardClass | 8/6.1 |
| PackingGroup | II |
| HS Code | 2926907090 |
