A2526312
5-Carboxy-2-chlorobenzeneboronic acid , ≥98% , 913835-75-3
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB42.40 | In Stock |
|
| 1G | RMB86.40 | In Stock |
|
| 5G | RMB340.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 228-244 |
| Boiling point: | 462.5±55.0 °C(Predicted) |
| Density | 1.55±0.1 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 3.98±0.10(Predicted) |
| color | White to Almost white |
| InChI | 1S/C7H6BClO4/c9-6-2-1-4(7(10)11)3-5(6)8(12)13/h1-3,12-13H,(H,10,11) |
| InChIKey | ZITWKFSVFMUWIE-UHFFFAOYSA-N |
| SMILES | OB(C1=CC(C(O)=O)=CC=C1Cl)O |
| CAS DataBase Reference | 913835-75-3 |
Description and Uses
suzuki reaction
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H318 |
| Precautionary statements | P280-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 41 |
| Safety Statements | 26-39 |
| WGK Germany | WGK 3 |
| Hazard Note | Irritant/Keep Cold |
| HazardClass | IRRITANT, KEEP COLD |
| HS Code | 2931900090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 |






