A2548512
4-Chlorophenyl Isothiocyanate , >98.0%(GC) , 2131-55-7
CAS NO.:2131-55-7
Empirical Formula: C7H4ClNS
Molecular Weight: 169.63
MDL number: MFCD00004810
EINECS: 218-358-3
| Pack Size | Price | Stock | Quantity |
| 5G | RMB95.20 | In Stock |
|
| 25G | RMB366.40 | In Stock |
|
| 100G | RMB1162.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 42-44 °C(lit.) |
| Boiling point: | 135-136 °C24 mm Hg(lit.) |
| Density | 1.3181 (rough estimate) |
| refractive index | 1.6100 (estimate) |
| Flash point: | 110 °C |
| storage temp. | Refrigerator (+4°C) |
| form | powder to crystal |
| color | White to Light yellow |
| Sensitive | Moisture Sensitive |
| BRN | 471610 |
| InChI | InChI=1S/C7H4ClNS/c8-6-1-3-7(4-2-6)9-5-10/h1-4H |
| InChIKey | MZZVFXMTZTVUFO-UHFFFAOYSA-N |
| SMILES | C1(Cl)=CC=C(N=C=S)C=C1 |
| CAS DataBase Reference | 2131-55-7(CAS DataBase Reference) |
Description and Uses
4-Chlorophenyl isothiocyanate has been used in the synthesis of thiosemicarbazides. It was also used as building block for the synthesis of N-alkylated 2-arylaminobenzimidazoles.
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H301+H311+H331-H315-H317-H319-H334-H335 |
| Precautionary statements | P261-P280-P301+P310-P302+P352+P312-P304+P340+P311-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T |
| Risk Statements | 23/24-36/37/38-42-42/43-23/24/25 |
| Safety Statements | 22-26-36/37/39-45-36/37 |
| RIDADR | UN 2206 6.1/PG 2 |
| WGK Germany | 3 |
| RTECS | NX8473000 |
| F | 10-21-19 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29309090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Eye Irrit. 2 Resp. Sens. 1 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |







