A2564212
2-Chloro-4-nitrotoluene , >98.0%(GC) , 121-86-8
Synonym(s):
2-Chloro-1-methyl-4-nitrobenzene
CAS NO.：121-86-8
Empirical Formula: C7H6ClNO2
Molecular Weight: 171.58
MDL number: MFCD00007210
EINECS: 204-501-7
| Pack Size | Price | Stock | Quantity |
| 5G | RMB45.60 | In Stock |
|
| 25G | RMB72.00 | In Stock |
|
| 100G | RMB319.20 | In Stock |
|
| 500G | RMB1279.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 61 °C |
| Boiling point: | 260 °C |
| Density | 1.3246 (rough estimate) |
| refractive index | 1.5470 (estimate) |
| Flash point: | 150 °C |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | acetonitrile: soluble |
| color | Pale Yellow |
| Water Solubility | 49 mg/L (20 ºC) |
| BRN | 1817924 |
| InChI | InChI=1S/C7H6ClNO2/c1-5-2-3-6(9(10)11)4-7(5)8/h2-4H,1H3 |
| InChIKey | LLYXJBROWQDVMI-UHFFFAOYSA-N |
| SMILES | C1(C)=CC=C([N+]([O-])=O)C=C1Cl |
| CAS DataBase Reference | 121-86-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 2-chloro-1-methyl-4-nitro-(121-86-8) |
| EPA Substance Registry System | 2-Chloro-4-nitrotoluene (121-86-8) |
Description and Uses
2-Chloro-4-nitrotoluene is a substituted toluene used in the preparation of wide range of compounds such as herbicides, analgesics and
Safety
| Symbol(GHS) |   GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H320-H411-H315-H401-H302-H319 |
| Precautionary statements | P264-P273-P305+P351+P338+P337+P313-P391-P501-P305+P351+P338-P280a-P321-P332+P313-P337+P313 |
| Hazard Codes | Xn,N |
| Risk Statements | 22-36/37/38-20/21/22-52/53 |
| Safety Statements | 36/37/39-26-61 |
| RIDADR | UN 3457 6.1/PG 3 |
| WGK Germany | 2 |
| RTECS | XS9100000 |
| TSCA | Yes |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29049090 |
| Hazardous Substances Data | 121-86-8(Hazardous Substances Data) |
