A2564412
2-Chloro-4-nitroanisole , >98.0%(GC) , 4920-79-0
CAS NO.：4920-79-0
Empirical Formula: C7H6ClNO3
Molecular Weight: 187.58
MDL number: MFCD00060681
EINECS: 225-547-4
| Pack Size | Price | Stock | Quantity |
| 5G | RMB34.40 | In Stock |
|
| 25G | RMB90.40 | In Stock |
|
| 100g | RMB316.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 94 °C |
| Boiling point: | 286.6±20.0 °C(Predicted) |
| Density | 1.366±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| Appearance | White to off-white Solid |
| InChI | InChI=1S/C7H6ClNO3/c1-12-7-3-2-5(9(10)11)4-6(7)8/h2-4H,1H3 |
| InChIKey | DLJPNXLHWMRQIQ-UHFFFAOYSA-N |
| SMILES | C1(OC)=CC=C([N+]([O-])=O)C=C1Cl |
| CAS DataBase Reference | 4920-79-0 |
| NIST Chemistry Reference | Benzene, 2-chloro-1-methoxy-4-nitro-(4920-79-0) |
Description and Uses
2-Chloro-4-nitoranisole can be used as pharmaceutical intermediate
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H320 |
| Precautionary statements | P264-P270-P301+P312+P330-P305+P351+P338+P337+P313-P501 |
| Hazard Codes | Xi |
| RTECS | BZ8578000 |
| HS Code | 2909.30.6000 |
| HazardClass | IRRITANT |
