A2569312
1,3-Cyclohexanedicarboxylic Acid (<i>cis</i>- and <i>trans</i>- mixture) , >98.0% , 3971-31-1
CAS NO.：3971-31-1
Empirical Formula: C8H12O4
Molecular Weight: 172.18
MDL number: MFCD00134411
EINECS: 432-490-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB64.80 | In Stock |
|
| 10G | RMB129.60 | In Stock |
|
| 25G | RMB260.00 | In Stock |
|
| 100G | RMB803.20 | In Stock |
|
| 500G | RMB7999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 132-141 °C(lit.) |
| Boiling point: | 332.4±25.0 °C(Predicted) |
| Density | 1.314±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 4.32±0.13(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C8H12O4/c9-7(10)5-2-1-3-6(4-5)8(11)12/h5-6H,1-4H2,(H,9,10)(H,11,12) |
| InChIKey | XBZSBBLNHFMTEB-UHFFFAOYSA-N |
| SMILES | C1(C(O)=O)CCCC(C(O)=O)C1 |
| CAS DataBase Reference | 3971-31-1(CAS DataBase Reference) |
| EPA Substance Registry System | 1,3-Cyclohexanedicarboxylic acid (3971-31-1) |
Description and Uses
1,3-Cyclohexanedicarboxylic acid can be used in the synthesis of organic materials and liquid crystal materials.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-41 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HS Code | 29172090 |
