A2716412
Cyclopentylboronic acid , 95% , 63076-51-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB35.20 | In Stock |
|
| 5g | RMB115.20 | In Stock |
|
| 10G | RMB183.20 | In Stock |
|
| 25g | RMB370.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 126 °C (dec.)(lit.) |
| Boiling point: | 235.0±23.0 °C(Predicted) |
| Density | 1.03±0.1 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| form | Crystalline Powder or Flakes |
| pka | 10.47±0.20(Predicted) |
| color | White to off-white |
| InChI | InChI=1S/C5H11BO2/c7-6(8)5-3-1-2-4-5/h5,7-8H,1-4H2 |
| InChIKey | VTTDFSNKIMAQTB-UHFFFAOYSA-N |
| SMILES | C1CCCC1B(O)O |
| CAS DataBase Reference | 63076-51-7(CAS DataBase Reference) |
Description and Uses
Reactant involved in:
- Cross coupling reactions with quinones or aromatic amines
- Arylation and alkylation of diphenylisoxazole
- Ruphos-mediated Suzuki cross coupling reactions
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H315-H319 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2931900090 |
| Storage Class | 11 - Combustible Solids |






