A2576712
Cyclopropyldiphenylsulfonium Tetrafluoroborate , >95.0% , 33462-81-6
CAS NO.:33462-81-6
Empirical Formula: C15H15BF4S
Molecular Weight: 314.15
MDL number: MFCD00011873
EINECS: 251-530-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB701.28 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 136-138 °C(lit.) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | a suspension in THF, DME, DMSO, MeCN |
| form | powder to crystal |
| color | White to Almost white |
| BRN | 4172245 |
| InChI | InChI=1S/C15H15S.BF4/c1-3-7-13(8-4-1)16(15-11-12-15)14-9-5-2-6-10-14;2-1(3,4)5/h1-10,15H,11-12H2;/q+1;-1 |
| InChIKey | DWEYKSWKFYZEGZ-UHFFFAOYSA-N |
| SMILES | [S+](C1C=CC=CC=1)(C1=CC=CC=C1)C1CC1.[B-](F)(F)(F)F |
| CAS DataBase Reference | 33462-81-6(CAS DataBase Reference) |
Description and Uses
CYCLOPROPYLDIPHENYLSULFONIUM TETRAFLUOROBORATE is used as a versatile C3 building block; reagent for the spiroannulation of carbonyl compounds.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 1759 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 2931900090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





