A2579812
5-Chloro-2-adamantanone , >98.0%(GC) , 20098-17-3
CAS NO.：20098-17-3
Empirical Formula: C10H13ClO
Molecular Weight: 184.66
MDL number: MFCD00798599
EINECS: 1806241-263-5
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB36.80 | In Stock |
|
| 1G | RMB111.20 | In Stock |
|
| 5G | RMB490.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 200 °C |
| Boiling point: | 289.1±33.0 °C(Predicted) |
| Density | 1.24±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C, stored under nitrogen |
| solubility | soluble in Methanol |
| form | powder to crystal |
| color | White to Almost white |
| InChI | InChI=1S/C10H13ClO/c11-10-3-6-1-7(4-10)9(12)8(2-6)5-10/h6-8H,1-5H2 |
| InChIKey | JPEOUSFBWXVGFX-UHFFFAOYSA-N |
| SMILES | C12CC3(Cl)CC(CC(C3)C1=O)C2 |
| CAS DataBase Reference | 20098-17-3(CAS DataBase Reference) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36 |
| HS Code | 2914.29.5000 |
| HazardClass | IRRITANT |
