BD9187047
Adamantane-1,3,5-triol , 97% , 99181-50-7
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB109.60 | In Stock |
|
| 250mg | RMB179.20 | In Stock |
|
| 1g | RMB464.00 | In Stock |
|
| 5g | RMB1624.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 203-207 °C |
| Boiling point: | 339.7±37.0 °C(Predicted) |
| Density | 1.606±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 14.03±0.60(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C10H16O3/c11-8-1-7-2-9(12,4-8)6-10(13,3-7)5-8/h7,11-13H,1-6H2 |
| InChIKey | MCYBYTIPMYLHAK-UHFFFAOYSA-N |
| SMILES | C12(O)CC3(O)CC(CC(O)(C3)C1)C2 |
| CAS DataBase Reference | 99181-50-7 |
Description and Uses
Adamantane-1,3,5-triol is an intermediate for the synthesis of adamantane-based trimeric cationic surfactants and other adamantane polyhydric alcohols.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P271-P280-P302+P352-P304+P340-P305+P351+P338-P330-P362+P364-P403+P233-P405-P501 |
| HS Code | 2906.19.5000 |






