A2581112
2-Chlorobutyric Acid , >90.0%(GC) , 4170-24-5
CAS NO.：4170-24-5
Empirical Formula: C4H7ClO2
Molecular Weight: 122.55
MDL number: MFCD00020496
EINECS: 224-029-5
| Pack Size | Price | Stock | Quantity |
| 1ML | RMB47.20 | In Stock |
|
| 5ML | RMB159.20 | In Stock |
|
| 25ML | RMB559.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 76.2-77 °C |
| Boiling point: | 90-92 °C12 mm Hg(lit.) |
| Density | 1.190 g/mL at 20 °C(lit.) |
| refractive index | n |
| Flash point: | 112°C |
| Water Solubility | Soluble in water |
| form | clear liquid |
| pka | 2.86(at RT℃) |
| color | Colorless to Light orange to Yellow |
| BRN | 1720944 |
| InChI | InChI=1S/C4H7ClO2/c1-2-3(5)4(6)7/h3H,2H2,1H3,(H,6,7) |
| InChIKey | RVBUZBPJAGZHSQ-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C(Cl)CC |
| CAS DataBase Reference | 4170-24-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Butanoic acid, 2-chloro-(4170-24-5) |
Description and Uses
2-Chlorobutyric acid was used in the synthesis of 2-hydroxy-5-hexenyl 2-chlorobutyrate ester.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363-P405 |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3265 8/PG 3 |
| WGK Germany | 3 |
| F | 19 |
| HS Code | 2915.90.1800 |
| HazardClass | 8 |
| PackingGroup | II |
