A2590012
3-(4-Chlorobenzoyl)propionic Acid , >98.0% , 3984-34-7
CAS NO.:3984-34-7
Empirical Formula: C10H9ClO3
Molecular Weight: 212.63
MDL number: MFCD00002794
EINECS: 223-627-3
| Pack Size | Price | Stock | Quantity |
| 5G | RMB63.20 | In Stock |
|
| 25G | RMB190.40 | In Stock |
|
| 100G | RMB751.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 128-130 °C (lit.) |
| Boiling point: | 305.28°C (rough estimate) |
| Density | 1.2781 (rough estimate) |
| refractive index | 1.5470 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | water: insoluble(lit.) |
| pka | 4.44±0.17(Predicted) |
| form | powder to crystal |
| color | White to Orange to Green |
| Water Solubility | Insoluble |
| BRN | 2104409 |
| InChI | InChI=1S/C10H9ClO3/c11-8-3-1-7(2-4-8)9(12)5-6-10(13)14/h1-4H,5-6H2,(H,13,14) |
| InChIKey | AHVASTJJVAYFPY-UHFFFAOYSA-N |
| SMILES | C1(C=CC(Cl)=CC=1)C(=O)CCC(=O)O |
| CAS DataBase Reference | 3984-34-7(CAS DataBase Reference) |
Description and Uses
NSC 5137, an aryl chloride, was studied in Pd-mediated Suzuki-Miyaura cross-coupling reactions with arylboronic acids, involving nucleophilic N-heterocyclic carbenes as ancilliary ligands.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-37-26 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29183000 |






