A2593812
<i>cis</i>-Decahydronaphthalene , >98.0%(GC) , 493-01-6
Synonym(s):
cis-Decalin
CAS NO.:493-01-6
Empirical Formula: C10H18
Molecular Weight: 138.25
MDL number: MFCD00064189
EINECS: 207-770-9
| Pack Size | Price | Stock | Quantity |
| 5ML | RMB127.20 | In Stock |
|
| 25ML | RMB375.20 | In Stock |
|
| 100ML | RMB895.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | −43 °C(lit.) |
| Boiling point: | 193 °C(lit.) |
| Density | 0.897 g/mL at 25 °C(lit.) |
| vapor density | 4.76 (vs air) |
| vapor pressure | 42 mm Hg ( 92 °C) |
| refractive index | n |
| Flash point: | 137 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Colorless to Almost colorless |
| explosive limit | 0.7-4.9%, 100°F |
| Water Solubility | 8.92g/L(300 ºC) |
| Merck | 14,2846 |
| BRN | 1900822 |
| Henry's Law Constant | 4.3×10-4 mol/(m3Pa) at 25℃, Mackay et al. (1993) |
| Dielectric constant | 2.2(20℃) |
| Stability: | Stable. Incompatible with oxidizing agents. May form explosive peroxides. Heat and light accelerate peroxide formation. |
| InChI | 1S/C10H18/c1-2-6-10-8-4-3-7-9(10)5-1/h9-10H,1-8H2/t9-,10+ |
| InChIKey | NNBZCPXTIHJBJL-AOOOYVTPSA-N |
| SMILES | [H][C@]12CCCC[C@@]1([H])CCCC2 |
| Surface tension | 32.1mN/m at 298.15K |
| CAS DataBase Reference | 493-01-6(CAS DataBase Reference) |
| EPA Substance Registry System | cis-Decahydronaphthalene (493-01-6) |
Description and Uses
cis-Decahydronaphthalene is used as a quantitation standard in the determination of sesquiterpanes.
Safety
| Symbol(GHS) | ![]() ![]() ![]() ![]() ![]() GHS02,GHS05,GHS06,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H226-H304-H314-H331-H411 |
| Precautionary statements | P210-P280-P301+P330+P331-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn,N,C |
| Risk Statements | 20-36/37/38-65-51/53-34 |
| Safety Statements | 26-36-62-61-45-36/37/39 |
| RIDADR | UN 1147 |
| WGK Germany | 3 |
| RTECS | QJ3150000 |
| Autoignition Temperature | 482 °F |
| TSCA | TSCA listed |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29021990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 3 Inhalation Aquatic Chronic 2 Asp. Tox. 1 Eye Irrit. 2 Flam. Liq. 3 Skin Corr. 1C |











