A2603512
5-Chloro-1-(4-piperidinyl)-2-benzimidazolinone , >98.0%(GC)(T) , 53786-28-0
CAS NO.:53786-28-0
Empirical Formula: C12H14ClN3O
Molecular Weight: 251.71
MDL number: MFCD02093793
EINECS: 258-771-6
| Pack Size | Price | Stock | Quantity |
| 1g | RMB63.20 | In Stock |
|
| 5G | RMB191.20 | In Stock |
|
| 25G | RMB639.20 | In Stock |
|
| 50g | RMB1039.20 | In Stock |
|
| 100g | RMB1759.20 | In Stock |
|
| 250g | RMB3599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 228-231 °C (lit.) |
| Density | 1.323±0.06 g/cm3(Predicted) |
| vapor pressure | 0Pa at 20℃ |
| storage temp. | Refrigerator |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 11.12±0.30(Predicted) |
| form | Powder to crystal |
| color | White to Off-White |
| Water Solubility | 549mg/L at 20℃ |
| InChI | InChI=1S/C12H14ClN3O/c13-8-1-2-11-10(7-8)15-12(17)16(11)9-3-5-14-6-4-9/h1-2,7,9,14H,3-6H2,(H,15,17) |
| InChIKey | DOAYWDKFDPSTSV-UHFFFAOYSA-N |
| SMILES | C1(=O)N(C2CCNCC2)C2=CC=C(Cl)C=C2N1 |
| LogP | -0.6 at 20℃ |
| CAS DataBase Reference | 53786-28-0(CAS DataBase Reference) |
Description and Uses
5-Chloro-1-(4-piperidinyl)-2-benzimidazolidinone (Domperidone EP Impurity A) is a metabolite of the gastrokinetic and antinauseant drug Domperidone (D531100).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280a-P304+P340-P405-P501a-P261-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29339980 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







