A3324512
Domperidone , ≥98% , 57808-66-9
Synonym(s):
4-(5-Chloro-2-oxo-1-benzimidazolinyl)-1-[3-(2-oxobenzimidazolinyl)propyl]piperidine
CAS NO.：57808-66-9
Empirical Formula: C22H24ClN5O2
Molecular Weight: 425.91
MDL number: MFCD00069256
EINECS: 260-968-7
| Pack Size | Price | Stock | Quantity |
| 5G | RMB36.80 | In Stock |
|
| 50MG | RMB55.20 | In Stock |
|
| 25G | RMB121.60 | In Stock |
|
| 250MG | RMB191.20 | In Stock |
|
| 100G | RMB374.40 | In Stock |
|
| 1G | RMB535.20 | In Stock |
|
| 500g | RMB1476.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 240-244°C |
| Density | 1.2904 (rough estimate) |
| refractive index | 1.5400 (estimate) |
| storage temp. | Store at RT |
| solubility | DMSO: >10 mg/mL |
| pka | pKa 7.90 (Uncertain) |
| form | solid |
| color | white |
| Water Solubility | Slightly soluble in water. |
| Merck | 14,3418 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Major Application | pharmaceutical (small molecule) |
| InChI | 1S/C22H24ClN5O2/c23-15-6-7-20-18(14-15)25-22(30)28(20)16-8-12-26(13-9-16)10-3-11-27-19-5-2-1-4-17(19)24-21(27)29/h1-2,4-7,14,16H,3,8-13H2,(H,24,29)(H,25,30) |
| InChIKey | FGXWKSZFVQUSTL-UHFFFAOYSA-N |
| SMILES | C1(=O)N(C2CCN(CCCN3C(=O)NC4=CC=CC=C43)CC2)C2=CC=C(Cl)C=C2N1 |
| CAS DataBase Reference | 57808-66-9(CAS DataBase Reference) |
Description and Uses
For management of dyspepsia, heartburn, epigastric pain, nausea, and vomiting.
Safety
| Symbol(GHS) |  GHS08 |
| Signal word | Warning |
| Hazard statements | H361fd |
| Precautionary statements | P201-P202-P280-P308+P313-P405-P501 |
| Hazard Codes | Xn |
| Risk Statements | 62-63 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | DE2275900 |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Repr. 2 |
