A2608812
3-Chloro-4-hydroxybenzoic Acid Hemihydrate , >98.0%(T) , 3964-58-7
CAS NO.：3964-58-7
Empirical Formula: C7H5ClO3
Molecular Weight: 172.57
MDL number: MFCD00002549
EINECS: 223-574-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB67.20 | In Stock |
|
| 10G | RMB127.20 | In Stock |
|
| 25G | RMB189.60 | In Stock |
|
| 50G | RMB375.20 | In Stock |
|
| 250G | RMB1599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 171-173 °C(lit.) |
| Boiling point: | 331℃ |
| Density | 1.536 |
| refractive index | 1.4580 (estimate) |
| Flash point: | 154℃ |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 4.20±0.10(Predicted) |
| color | White to Almost white |
| BRN | 2207866 |
| InChI | 1S/2C7H5ClO3.H2O/c2*8-5-3-4(7(10)11)1-2-6(5)9;/h2*1-3,9H,(H,10,11);1H2 |
| InChIKey | VXRQGICSNYPXAC-UHFFFAOYSA-N |
| SMILES | O.OC(=O)c1ccc(O)c(Cl)c1.OC(=O)c2ccc(O)c(Cl)c2 |
| CAS DataBase Reference | 3964-58-7(CAS DataBase Reference) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HS Code | 29182900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
