BD0987732
3,5-Dichloro-4-methoxybenzoic acid , 97% , 37908-97-7
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB51.20 | In Stock |
|
| 1g | RMB132.80 | In Stock |
|
| 5g | RMB550.40 | In Stock |
|
| 10g | RMB1062.40 | In Stock |
|
| 25g | RMB2193.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 202 °C |
| Boiling point: | 328.9±37.0 °C(Predicted) |
| Density | 1.474±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | solid |
| pka | 3.73±0.10(Predicted) |
| color | Off-white |
| InChI | InChI=1S/C8H6Cl2O3/c1-13-7-5(9)2-4(8(11)12)3-6(7)10/h2-3H,1H3,(H,11,12) |
| InChIKey | XSYZTYQXKIXPRC-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC(Cl)=C(OC)C(Cl)=C1 |
Description and Uses
3,5-dichloro-4-methoxybenzoic acid is a degradation product in plant and soil.
3,5-dichloro-4-methoxybenzoic acid is an important raw material for the synthesis of dotenororil.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| HS Code | 2918999090 |






