A2613051
Dibenzo[b,d]Furan-3-YlboronicAcid , 99% , 395087-89-5
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB44.80 | In Stock |
|
| 1g | RMB119.20 | In Stock |
|
| 5g | RMB341.60 | In Stock |
|
| 25g | RMB1200.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 438.5±37.0 °C(Predicted) |
| Density | 1.34±0.1 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | 8.20±0.30(Predicted) |
| Appearance | White to off-white Solid |
| InChI | InChI=1S/C12H9BO3/c14-13(15)8-5-6-10-9-3-1-2-4-11(9)16-12(10)7-8/h1-7,14-15H |
| InChIKey | FQENSZQWKVWYPA-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C2C3=CC=CC=C3OC2=C1)(O)O |
Description and Uses
Dibenzo[b,d]furan-3-ylboronic acid can be used as organic synthesis intermediates and pharmaceutical intermediates, mainly used in laboratory research and development and chemical and pharmaceutical production processes.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| HS Code | 2931900090 |

![Dibenzo[b,d]Furan-3-YlboronicAcid](https://img.chemicalbook.com/CAS/20200119/GIF/395087-89-5.gif)


![Dibenzo[b,d]furan-2-ylboronic acid](https://img.chemicalbook.com/CAS/GIF/402936-15-6.gif)

![Dibenzo[b,d]furan-4-carbaldehyde](https://img.chemicalbook.com/CAS/GIF/96706-46-6.gif)