BD0179548
Dibenzo[b,d]furan-4-carbaldehyde , 98% , 96706-46-6
| Pack Size | Price | Stock | Quantity |
| 1g | RMB192.00 | In Stock |
|
| 5g | RMB635.20 | In Stock |
|
| 25g | RMB2115.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 94-98 °F(lit.) |
| Boiling point: | 360.5±15.0 °C(Predicted) |
| Density | 1.289±0.06 g/cm3 (20 ºC 760 Torr) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | powder to crystal |
| color | White to Orange to Green |
| InChI | 1S/C13H8O2/c14-8-9-4-3-6-11-10-5-1-2-7-12(10)15-13(9)11/h1-8H |
| InChIKey | GQYTWBPRZFRASB-UHFFFAOYSA-N |
| SMILES | [H]C(=O)c1cccc2c3ccccc3oc12 |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2932990090 |
| Storage Class | 11 - Combustible Solids |

![Dibenzo[b,d]furan-4-carbaldehyde](https://img.chemicalbook.com/CAS/GIF/96706-46-6.gif)



![Dibenzo[b,d]Furan-3-YlboronicAcid](https://img.chemicalbook.com/CAS/20200119/GIF/395087-89-5.gif)
![Dibenzo[b,d]furan-2-ylboronic acid](https://img.chemicalbook.com/CAS/GIF/402936-15-6.gif)