A3667312
Dibenzofuran-<WBR>4-<WBR>carboxylic acid , 97% , 2786-05-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB455.20 | In Stock |
|
| 5g | RMB1279.20 | In Stock |
|
| 25g | RMB4799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 211-215 °C(lit.) |
| Boiling point: | 425.7±18.0 °C(Predicted) |
| Density | 1.387±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMF: 30 mg/ml DMSO: 30 mg/ml Ethanol: 1 mg/ml |
| form | solid |
| pka | 3.24±0.30(Predicted) |
| color | White to light yellow |
| InChI | InChI=1S/C13H8O3/c14-13(15)10-6-3-5-9-8-4-1-2-7-11(8)16-12(9)10/h1-7H,(H,14,15) |
| InChIKey | BSMAWCXKHJSJIB-UHFFFAOYSA-N |
| SMILES | O1C2=CC=CC=C2C2=CC=CC(C(O)=O)=C12 |
Description and Uses
4-Dibenzofurancarboxylic acid is one of the synthesis materials of polycyclic aromatic hydrocarbons (PAHs) and Schistosoma mansoni histone deacetylase 8 (smHDAC8) inhibitors[1][2].
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| Storage Class | 13 - Non Combustible Solids |



![Dibenzo[b,d]furan-4-carbaldehyde](https://img.chemicalbook.com/CAS/GIF/96706-46-6.gif)
![methyl dibenzo[b,d]furan-4-carboxylate](https://img.chemicalbook.com/CAS/20180527/GIF/92151-89-8.gif)


