A3667312
                    Dibenzofuran-<WBR>4-<WBR>carboxylic acid , 97% , 2786-05-2
| Pack Size | Price | Stock | Quantity | 
| 1G | RMB455.20 | In Stock | 
                                                 | 
                                        
| 5g | RMB1279.20 | In Stock | 
                                                 | 
                                        
| 25g | RMB4799.20 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Melting point: | 211-215 °C(lit.) | 
                                    
| Boiling point: | 425.7±18.0 °C(Predicted) | 
                                    
| Density | 1.387±0.06 g/cm3(Predicted) | 
                                    
| storage temp. | 2-8°C | 
                                    
| solubility | DMF: 30 mg/ml DMSO: 30 mg/ml Ethanol: 1 mg/ml  | 
                                    
| pka | 3.24±0.30(Predicted) | 
                                    
| form | solid | 
                                    
| color | White to light yellow | 
                                    
| InChI | InChI=1S/C13H8O3/c14-13(15)10-6-3-5-9-8-4-1-2-7-11(8)16-12(9)10/h1-7H,(H,14,15) | 
                                    
| InChIKey | BSMAWCXKHJSJIB-UHFFFAOYSA-N | 
                                    
| SMILES | O1C2=CC=CC=C2C2=CC=CC(C(O)=O)=C12 | 
                                    
Description and Uses
4-Dibenzofurancarboxylic acid is one of the synthesis materials of polycyclic aromatic hydrocarbons (PAHs) and Schistosoma mansoni histone deacetylase 8 (smHDAC8) inhibitors[1][2].
Safety
| Symbol(GHS) | ![]() GHS07  | 
                                    
| Signal word | Warning | 
| Hazard statements | H315-H319 | 
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 | 
| Safety Statements | 22-24/25 | 
| WGK Germany | 3 | 



![Dibenzo[b,d]furan-4-carbaldehyde](https://img.chemicalbook.com/CAS/GIF/96706-46-6.gif)
![methyl dibenzo[b,d]furan-4-carboxylate](https://img.chemicalbook.com/CAS/20180527/GIF/92151-89-8.gif)


