PRODUCT Properties
| Melting point: | 55-59 °C |
| Boiling point: | 208 °C25 mm Hg(lit.) |
| Density | d462 1.0712 |
| refractive index | nD62 1.6458 |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | dioxane: soluble1g/10 mL, clear, colorless |
| form | Granular Powder |
| pka | -5.6 |
| color | Yellow |
| Merck | 14,2037 |
| BRN | 1210466 |
| InChI | InChI=1S/C15H12O/c16-15(14-9-5-2-6-10-14)12-11-13-7-3-1-4-8-13/h1-12H |
| InChIKey | DQFBYFPFKXHELB-UHFFFAOYSA-N |
| SMILES | C(C1=CC=CC=C1)(=O)C=CC1=CC=CC=C1 |
| LogP | 3.080 |
| CAS DataBase Reference | 94-41-7(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Propen-1-one, 1,3-diphenyl- (94-41-7) |
Description and Uses
Chalcone is the organic compound C6H5C(O)CH=CHC6H5. It is an α,β-unsaturated ketone. A variety of important biological compounds are known collectively as chalcones or chalconoids.They show antibacterial, antifungal, antitumor and anti-inflammatory properties. They are also intermediates in the biosynthesis of flavonoids, which are substances widespread in plants and with an array of biological activities. Chalcones are also intermediates in the Auwers synthesis of flavones.
1,3-Diphenyl-2-propenone was used in the preparation of pharmacologically-interesting heterocyclic systems like pyrazolines and pyrimidines.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H302-H319-H335 |
| Precautionary statements | P261-P305+P351+P338-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37 |
| Safety Statements | 22-36/37/39-45 |
| WGK Germany | 3 |
| RTECS | UD5576750 |
| TSCA | TSCA listed |
| HS Code | 29143900 |
| Storage Class | 11 - Combustible Solids |







