A5059912
trans-Chalcone , 97% , 614-47-1
Synonym(s):
Benzalacetophenone;Benzylideneacetophenone;Chalcone
CAS NO.:614-47-1
Empirical Formula: C15H12O
Molecular Weight: 208.26
MDL number: MFCD00003082
EINECS: 210-383-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB35.20 | In Stock |
|
| 25g | RMB50.40 | In Stock |
|
| 100G | RMB158.40 | In Stock |
|
| 250g | RMB311.20 | In Stock |
|
| 500G | RMB581.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 55-59 °C |
| Boiling point: | 208 °C25 mm Hg(lit.) |
| Density | 1.0712 |
| refractive index | 1.5361 (estimate) |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly) |
| form | Solid |
| color | Pale Yellow |
| Odor | at 100.00 %. floral balsam herbal |
| Odor Type | floral |
| Water Solubility | Soluble in chloroform, ether, benzene, and ethanol (slightly). Insoluble in water. |
| Merck | 14,2037 |
| BRN | 509985 |
| InChI | 1S/C15H12O/c16-15(14-9-5-2-6-10-14)12-11-13-7-3-1-4-8-13/h1-12H/b12-11+ |
| InChIKey | DQFBYFPFKXHELB-VAWYXSNFSA-N |
| SMILES | [H]\C(=C(\[H])C(=O)c1ccccc1)c2ccccc2 |
| LogP | 4.013 (est) |
| CAS DataBase Reference | 614-47-1(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzalacetophenone(614-47-1) |
Description and Uses
trans-Chalcone is an open chain flavonoid that may prevent lung and forestomach cancer.
trans-Chalcone is a positive allosteric modulator of α7 nicotinic acetylcholine receptors and exhibits antioxidant activity.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H319-H335 |
| Precautionary statements | P261-P264-P270-P271-P301+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37 |
| Safety Statements | 22-36/37/39-45 |
| WGK Germany | 3 |
| RTECS | UD5576750 |
| HS Code | 29143990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 STOT SE 3 |







