F208323
trans,trans-2,4-Undecadienal , 90+ , 30361-29-6
CAS NO.:30361-29-6
Empirical Formula: C11H18O
Molecular Weight: 166.26
MDL number: MFCD00014677
EINECS: 250-148-7
| Pack Size | Price | Stock | Quantity |
| 5g | RMB1090.40 | In Stock |
|
| 25g | RMB4693.60 | In Stock |
|
| 100g | RMB11068.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 170-172°C |
| Boiling point: | 128-129°C 10mm |
| Density | 0.869 g/mL at 25 °C(lit.) |
| FEMA | 3422 | 2,4-UNDECADIENAL |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Hygroscopic, -20°C Freezer, Under Inert Atmosphere |
| solubility | DMSO, Methanol |
| form | Solid |
| color | White to Off-White |
| Odor | at 1.00 % in dipropylene glycol. oily caramellic spicy citrus buttery baked |
| Odor Type | green |
| biological source | synthetic |
| Sensitive | Air Sensitive |
| BRN | 1706330 |
| Major Application | flavors and fragrances |
| Cosmetics Ingredients Functions | PERFUMING |
| InChI | 1S/C11H18O/c1-2-3-4-5-6-7-8-9-10-11-12/h7-11H,2-6H2,1H3/b8-7+,10-9+ |
| InChIKey | UVIUIIFPIWRILL-XBLVEGMJSA-N |
| SMILES | [H]C(=O)\C([H])=C([H])\C([H])=C(/[H])CCCCCC |
| LogP | 3.71 |
| CAS DataBase Reference | 30361-29-6(CAS DataBase Reference) |
| NIST Chemistry Reference | 2,4-Undecadienal, (e,e)-(30361-29-6) |
| EPA Substance Registry System | 2,4-Undecadienal, (2E,4E)- (30361-29-6) |
Description and Uses
An intermediate for the synthesis of mivacurium
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29121900 |
| Storage Class | 10 - Combustible liquids |




