A2613912
4-Chlorobenzohydrazide , >98.0%(GC)(T) , 536-40-3
CAS NO.：536-40-3
Empirical Formula: C7H7ClN2O
Molecular Weight: 170.6
MDL number: MFCD00007603
EINECS: 208-632-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB78.40 | In Stock |
|
| 25G | RMB294.40 | In Stock |
|
| 100g | RMB1128.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 162-165 °C (lit.) |
| Boiling point: | 170.60°C |
| Density | 1.323 |
| refractive index | 1.5618 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 12.09±0.10(Predicted) |
| color | White to Almost white |
| BRN | 511154 |
| InChI | InChI=1S/C7H7ClN2O/c8-6-3-1-5(2-4-6)7(11)10-9/h1-4H,9H2,(H,10,11) |
| InChIKey | PKBGHORNUFQAAW-UHFFFAOYSA-N |
| SMILES | C(NN)(=O)C1=CC=C(Cl)C=C1 |
| CAS DataBase Reference | 536-40-3(CAS DataBase Reference) |
Description and Uses
4-Chlorobenzhydrazide has been used in preparation of:
- rod-shaped mesogenic hydrazide derivatives via Schotten-Baumann reaction with 4-n-alkoxybenzoyl chloride
- 4-methoxybenzaldehyde-4-chlorophenyl-1-carbonyl hydrazone
- 4-hydroxybenzaldehyde-4-chlorophenyl-1-carbonylhydrazone
- 2-nitrobenzaldehyde-4-chlorophenyl-1-carbonylhydrazone
- benzaldehyde-4-chlorophenyl-1-carbonylhydrazone
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29280000 |
