A2617112
3-Cyano-4-methoxy-2-pyridone , >98.0%(HPLC) , 21642-98-8
CAS NO.：21642-98-8
Empirical Formula: C7H6N2O2
Molecular Weight: 150.13
MDL number: MFCD00975442
EINECS: 800-656-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB37.60 | In Stock |
|
| 25G | RMB104.00 | In Stock |
|
| 100G | RMB395.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 293°C |
| Boiling point: | 421.8±45.0 °C(Predicted) |
| Density | 1.27±0.1 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Soluble in Dimethyl sulfoxide. |
| pka | 7.99±0.10(Predicted) |
| form | Crystalline Solid |
| color | Pale yellow |
| Sensitive | Hygroscopic |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C7H6N2O2/c1-11-6-2-3-9-7(10)5(6)4-8/h2-3H,1H3,(H,9,10) |
| InChIKey | MWGIDWPSRDMIQN-UHFFFAOYSA-N |
| SMILES | C1(=O)NC=CC(OC)=C1C#N |
| CAS DataBase Reference | 21642-98-8(CAS DataBase Reference) |
Description and Uses
N-Demethylricinine is a demethylated metabolite of Ricinine (R495550), an alkaloid extract from the castor-oil plant (Ricinus communalis). N-Demethylricinine is an impurity in the production of Gime racil.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H312-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi,Xn,T |
| Risk Statements | 20/21/22-36/37/38-22-25 |
| Safety Statements | 26-36/37/39-45-24/25 |
| RIDADR | 3439 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29349990 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
