A6780612
Piroctone olamine , Analysis standard , 68890-66-4
Synonym(s):
1-Hydroxy-4-methyl-6-(2,4,4-trimethylpentyl)-2(1H)-pyridone ethanolammonium salt
CAS NO.:68890-66-4
Empirical Formula: C16H30N2O3
Molecular Weight: 298.43
MDL number: MFCD01690792
EINECS: 272-574-2
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB643.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 134.0 to 138.0 °C |
| Boiling point: | 135-235℃[at 101 325 Pa] |
| Density | 1.1[at 20℃] |
| vapor pressure | 0-0Pa at 20-25℃ |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Chloroform (Slightly, Sonicated), Methanol (Slightly) |
| pka | 5.9-7.4[at 20 ℃] |
| form | Solid |
| color | White to Off-White |
| Water Solubility | 400-50000mg/L at 20-25℃ |
| Merck | 14,7502 |
| InChI | InChI=1S/C14H23NO2.C2H7NO/c1-10-6-12(15(17)13(16)8-10)7-11(2)9-14(3,4)5;3-1-2-4/h6,8,11,17H,7,9H2,1-5H3;4H,1-3H2 |
| InChIKey | BTSZTGGZJQFALU-UHFFFAOYSA-N |
| SMILES | C(N)CO.C(C1=CC(C)=CC(=O)N1O)C(C)CC(C)(C)C |
| LogP | 1.05-3.86 at 20-25℃ |
| CAS DataBase Reference | 68890-66-4(CAS DataBase Reference) |
Description and Uses
Piroctone Olamine is an anti-dandruff agent used in shampoo formulations.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H315-H318-H412 |
| Precautionary statements | P273-P280-P302+P352-P305+P351+P338+P310 |
| WGK Germany | 2 |
| RTECS | UU7786150 |
| HS Code | 2933399090 |






