A2617612
4'-Carboxybenzo-15-crown 5-Ether , >98.0% , 56683-55-7
Synonym(s):
(Benzo-15-crown-5)-4′-carboxylic acid
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB719.20 | In Stock |
|
| 1G | RMB1739.20 | In Stock |
|
| 5g | RMB7999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 188-191 °C |
| Boiling point: | 412.24°C (rough estimate) |
| Density | 1.184 |
| refractive index | 1.6380 (estimate) |
| storage temp. | 2-8°C |
| solubility | almost transparency in hot Methanol |
| form | powder to crystal |
| pka | 4.25±0.20(Predicted) |
| color | White to Almost white |
| BRN | 1597153 |
| InChI | 1S/C15H20O7/c16-15(17)12-1-2-13-14(11-12)22-10-8-20-6-4-18-3-5-19-7-9-21-13/h1-2,11H,3-10H2,(H,16,17) |
| InChIKey | FBNLTQGIRRAGRY-UHFFFAOYSA-N |
| SMILES | OC(=O)c1ccc2OCCOCCOCCOCCOc2c1 |
Description and Uses
4''-Carboxybenzo-15-crown-5 is a versatile crown ether used as a reactant in the preparation of β-diketone Gadolinium chelates for the detection of K+ or Mg2+ and Ca2+ ions.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-36-26 |
| WGK Germany | 3 |
| HS Code | 29329990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
