A2621212
4-Chlorophenoxyacetyl Chloride , >98.0%(T) , 4122-68-3
CAS NO.：4122-68-3
Empirical Formula: C8H6Cl2O2
Molecular Weight: 205.04
MDL number: MFCD00000727
EINECS: 223-923-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB120.00 | In Stock |
|
| 10G | RMB215.20 | In Stock |
|
| 25G | RMB304.80 | In Stock |
|
| 100G | RMB1015.20 | In Stock |
|
| 500G | RMB3500.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 18.8 °C (lit.) |
| Boiling point: | 142 °C/17 mmHg (lit.) |
| Density | 1.314 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| FreezingPoint | 15.0 to 23.0 ℃ |
| Sensitive | Moisture Sensitive |
| BRN | 609718 |
| InChI | InChI=1S/C8H6Cl2O2/c9-6-1-3-7(4-2-6)12-5-8(10)11/h1-4H,5H2 |
| InChIKey | VRBVHQUSAOKVDH-UHFFFAOYSA-N |
| SMILES | C(Cl)(COC1=CC=C(Cl)C=C1)=O |
Description and Uses
4-Chlorophenoxyacetyl chloride was used in the preparation of:
- substituted acetophenone derivatives
- 2-(4-chlorophenoxyacetylamino)-3-ethoxycarbonyl[2,3-b]quinuclidine
- 2-(4-chlorophenoxy)-N′-[2-(4-chlorophenoxy)acetyl]acetohydrazide monohydrate
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H290-H318-H314 |
| Precautionary statements | P280-P305+P351+P338-P310-P260h-P301+P330+P331-P303+P361+P353-P501a-P234-P260-P264-P301+P330+P331+P310-P303+P361+P353+P310+P363-P304+P340+P310-P305+P351+P338+P310-P390-P405-P406-P501 |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 23-26-36/37/39-45 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29189900 |
