A2623612
(3-Chlorobenzoyl)acetonitrile , >95.0%(HPLC) , 21667-62-9
Synonym(s):
3-Chloro-β-oxobenzenepropanenitrile;3-Chlorophenacyl cyanide;3-Oxo-3-(3-chlorophenyl)propionitrile
CAS NO.:21667-62-9
Empirical Formula: C9H6ClNO
Molecular Weight: 179.6
MDL number: MFCD00067891
EINECS: 626-892-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB46.40 | In Stock |
|
| 5G | RMB180.80 | In Stock |
|
| 10G | RMB320.80 | In Stock |
|
| 25G | RMB704.00 | In Stock |
|
| 100G | RMB2128.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 79-83 °C |
| Boiling point: | 347.1±27.0 °C(Predicted) |
| Density | 1.257±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 7.12±0.10(Predicted) |
| color | White to Light yellow to Light orange |
| BRN | 2414476 |
| InChI | InChI=1S/C9H6ClNO/c10-8-3-1-2-7(6-8)9(12)4-5-11/h1-3,6H,4H2 |
| InChIKey | IUDFNNHFARLIPF-UHFFFAOYSA-N |
| SMILES | C1(=CC=CC(Cl)=C1)C(=O)CC#N |
| CAS DataBase Reference | 21667-62-9(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352+P312-P304+P340+P312 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22-22 |
| Safety Statements | 26-36/37/39-36/37 |
| RIDADR | 3276 |
| WGK Germany | 3 |
| Hazard Note | Harmful/Irritant |
| HazardClass | IRRITANT |
| PackingGroup | III |
| HS Code | 29269090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral |






