A2626612
4-Cyanopyridine <i>N</i>-Oxide , >98.0%(T) , 14906-59-3
Synonym(s):
Isonicotinonitrile 1-oxide
CAS NO.:14906-59-3
Empirical Formula: C6H4N2O
Molecular Weight: 120.11
MDL number: MFCD00006205
EINECS: 238-974-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB31.20 | In Stock |
|
| 25G | RMB96.00 | In Stock |
|
| 100G | RMB299.20 | In Stock |
|
| 500G | RMB1439.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 223-225 °C(lit.) |
| Boiling point: | 382.7±15.0 °C(Predicted) |
| Density | 1.14±0.1 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | 1 M NH4OH: soluble5mg/mL, clear, colorless (methanol) |
| pka | -0.86±0.10(Predicted) |
| form | Solid |
| color | White to Off-White |
| InChI | InChI=1S/C6H4N2O/c7-5-6-1-3-8(9)4-2-6/h1-4H |
| InChIKey | QNCSFBSIWVBTHE-UHFFFAOYSA-N |
| SMILES | C1[N+]([O-])=CC=C(C#N)C=1 |
| CAS DataBase Reference | 14906-59-3(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Pyridinecarbonitrile, 1-oxide(14906-59-3) |
| EPA Substance Registry System | 4-Pyridinecarbonitrile 1-oxide (14906-59-3) |
Description and Uses
4-Cyanopyridine N-oxide is a heterocyclic compound and is an intermediate in the preparation of Topiostat. It is also used as a ligand for other metals or compounds for the formation of new dimeric complexes. It is commonly used in chemical materials research.
Anti-bacterial agent.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-37/39-36/37/39-22-36 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





