BD1211132
Methyl 2-cyanoisonicotinate , 98% , 94413-64-6
| Pack Size | Price | Stock | Quantity |
| 1g | RMB27.20 | In Stock |
|
| 5g | RMB82.40 | In Stock |
|
| 10g | RMB155.20 | In Stock |
|
| 25g | RMB311.20 | In Stock |
|
| 100g | RMB891.20 | In Stock |
|
| 500g | RMB3847.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 107-109℃ |
| Boiling point: | 296.6±25.0 °C(Predicted) |
| Density | 1.25±0.1 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | -2.43±0.10(Predicted) |
| form | Solid |
| color | Pale brown |
| Water Solubility | Slightly Soluble in water (6.2 g/L) (25°C). |
| InChI | InChI=1S/C8H6N2O2/c1-12-8(11)6-2-3-10-7(4-6)5-9/h2-4H,1H3 |
| InChIKey | ORVHMLCJEKDDAX-UHFFFAOYSA-N |
| SMILES | C1(C#N)=NC=CC(C(OC)=O)=C1 |
Description and Uses
Methyl 2-cyanoisonicotinate can be used in the synthesis of various pharmaceutical and biologically active compounds, such as tetra substituted imidazolines as potent and selective neuropeptide Y (NPY) Y5 receptor antagonists.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H312-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P304+P340-P305+P351+P338-P405-P501a |
| HazardClass | 6.1 |
![Pyridine, 4-[5-(4-pyridinyl)-1H-1,2,4-triazol-3-yl]-, 1-oxide](https://img.chemicalbook.com/CAS/20180702/GIF/36770-53-3.gif)
